C17H15Cl2N3O4 — CID 19659942
N-(3,4-dichlorophenyl)-N'-[(E)-(2,5-dimethoxyphenyl)methylideneamino]oxamide (PubChem CID 19659942) has the molecular formula C17H15Cl2N3O4 and a molecular weight of 396.23 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-N'-[(E)-(2,5-dimethoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-(3,4-dichlorophenyl)-N'-[(E)-(2,5-dimethoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 19659942 |
| Molecular Formula | C17H15Cl2N3O4 |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | N-(3,4-dichlorophenyl)-N'-[(E)-(2,5-dimethoxyphenyl)methylideneamino]oxamide |
| SMILES | COc1ccc(OC)c(/C=N/NC(=O)C(=O)Nc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C17H15Cl2N3O4/c1-25-12-4-6-15(26-2)10(7-12)9-20-22-17(24)16(23)21-11-3-5-13(18)14(19)8-11/h3-9H,1-2H3,(H,21,23)(H,22,24)/b20-9+ |
| InChIKey | RPZLONUGCOUSKY-AWQFTUOYSA-N |
| XLogP | 3.10 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|