C23H21N3O5 — CID 94846398
N'-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]-N-(4-phenoxyphenyl)oxamide (PubChem CID 94846398) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is N'-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]-N-(4-phenoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]-N-(4-phenoxyphenyl)oxamide |
|---|---|
| PubChem CID | 94846398 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N'-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]-N-(4-phenoxyphenyl)oxamide |
| SMILES | COc1ccc(OC)c(/C=N\NC(=O)C(=O)Nc2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C23H21N3O5/c1-29-20-12-13-21(30-2)16(14-20)15-24-26-23(28)22(27)25-17-8-10-19(11-9-17)31-18-6-4-3-5-7-18/h3-15H,1-2H3,(H,25,27)(H,26,28)/b24-15- |
| InChIKey | KNGBLSOKPNMTTJ-IWIPYMOSSA-N |
| XLogP | 3.58 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|