C21H15Cl2N3O3 — CID 94846395
N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]-N-(4-phenoxyphenyl)oxamide (PubChem CID 94846395) has the molecular formula C21H15Cl2N3O3 and a molecular weight of 428.28 g/mol. Its IUPAC name is N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]-N-(4-phenoxyphenyl)oxamide.
| Compound Name | N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]-N-(4-phenoxyphenyl)oxamide |
|---|---|
| PubChem CID | 94846395 |
| Molecular Formula | C21H15Cl2N3O3 |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | N'-[(Z)-(2,4-dichlorophenyl)methylideneamino]-N-(4-phenoxyphenyl)oxamide |
| SMILES | O=C(N/N=C\c1ccc(Cl)cc1Cl)C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C21H15Cl2N3O3/c22-15-7-6-14(19(23)12-15)13-24-26-21(28)20(27)25-16-8-10-18(11-9-16)29-17-4-2-1-3-5-17/h1-13H,(H,25,27)(H,26,28)/b24-13- |
| InChIKey | MMYRTTZNLLXSRG-CFRMEGHHSA-N |
| XLogP | 4.87 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|