C23H22N2O5 — CID 3406373
N-[(2,5-dimethoxyphenyl)methylideneamino]-2,2-diphenoxyacetamide (PubChem CID 3406373) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)methylideneamino]-2,2-diphenoxyacetamide.
| Compound Name | N-[(2,5-dimethoxyphenyl)methylideneamino]-2,2-diphenoxyacetamide |
|---|---|
| PubChem CID | 3406373 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)methylideneamino]-2,2-diphenoxyacetamide |
| SMILES | COc1ccc(OC)c(C=NNC(=O)C(Oc2ccccc2)Oc2ccccc2)c1 |
| InChI | InChI=1S/C23H22N2O5/c1-27-20-13-14-21(28-2)17(15-20)16-24-25-22(26)23(29-18-9-5-3-6-10-18)30-19-11-7-4-8-12-19/h3-16,23H,1-2H3,(H,25,26) |
| InChIKey | MVOQJFSEYADPRW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|