C25H27N3O6S — CID 126034810
(2S)-N-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide (PubChem CID 126034810) has the molecular formula C25H27N3O6S and a molecular weight of 497.57 g/mol. Its IUPAC name is (2S)-N-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide.
| Compound Name | (2S)-N-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide |
|---|---|
| PubChem CID | 126034810 |
| Molecular Formula | C25H27N3O6S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | (2S)-N-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide |
| SMILES | COc1ccc(OC)c(/C=N\NC(=O)[C@H](C)N(c2ccc(Oc3ccccc3)cc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C25H27N3O6S/c1-18(25(29)27-26-17-19-16-23(32-2)14-15-24(19)33-3)28(35(4,30)31)20-10-12-22(13-11-20)34-21-8-6-5-7-9-21/h5-18H,1-4H3,(H,27,29)/b26-17-/t18-/m0/s1 |
| InChIKey | MMVKJZQBTSVYRS-QVTRDURHSA-N |
| XLogP | 3.80 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|