C24H23N3O6S — CID 126032111
2-[(Z)-[[(2R)-2-(N-methylsulfonyl-4-phenoxyanilino)propanoyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 126032111) has the molecular formula C24H23N3O6S and a molecular weight of 481.53 g/mol. Its IUPAC name is 2-[(Z)-[[(2R)-2-(N-methylsulfonyl-4-phenoxyanilino)propanoyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 2-[(Z)-[[(2R)-2-(N-methylsulfonyl-4-phenoxyanilino)propanoyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 126032111 |
| Molecular Formula | C24H23N3O6S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 2-[(Z)-[[(2R)-2-(N-methylsulfonyl-4-phenoxyanilino)propanoyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | C[C@H](C(=O)N/N=C\c1ccccc1C(=O)O)N(c1ccc(Oc2ccccc2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C24H23N3O6S/c1-17(23(28)26-25-16-18-8-6-7-11-22(18)24(29)30)27(34(2,31)32)19-12-14-21(15-13-19)33-20-9-4-3-5-10-20/h3-17H,1-2H3,(H,26,28)(H,29,30)/b25-16-/t17-/m1/s1 |
| InChIKey | WSAOFKBKUZQYGO-GGMUZDTOSA-N |
| XLogP | 3.48 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|