C32H32N4O7S — CID 126032195
(2R)-N-[(Z)-[4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide (PubChem CID 126032195) has the molecular formula C32H32N4O7S and a molecular weight of 616.70 g/mol. Its IUPAC name is (2R)-N-[(Z)-[4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide.
| Compound Name | (2R)-N-[(Z)-[4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide |
|---|---|
| PubChem CID | 126032195 |
| Molecular Formula | C32H32N4O7S |
| Molecular Weight | 616.70 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | (2R)-N-[(Z)-[4-[2-(4-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(/C=N\NC(=O)[C@@H](C)N(c3ccc(Oc4ccccc4)cc3)S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C32H32N4O7S/c1-23(36(44(3,39)40)26-13-19-30(20-14-26)43-29-7-5-4-6-8-29)32(38)35-33-21-24-9-15-28(16-10-24)42-22-31(37)34-25-11-17-27(41-2)18-12-25/h4-21,23H,22H2,1-3H3,(H,34,37)(H,35,38)/b33-21-/t23-/m1/s1 |
| InChIKey | UXTVCGLEYYSFKV-MFVRALHWSA-N |
| XLogP | 4.81 |
| TPSA | 135.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.70 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|