C25H25FN4O5S — CID 9498435
(2S)-N-[(Z)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-methylsulfonylanilino)propanamide (PubChem CID 9498435) has the molecular formula C25H25FN4O5S and a molecular weight of 512.56 g/mol. Its IUPAC name is (2S)-N-[(Z)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-methylsulfonylanilino)propanamide.
| Compound Name | (2S)-N-[(Z)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 9498435 |
| Molecular Formula | C25H25FN4O5S |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | (2S)-N-[(Z)-[4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-methylsulfonylanilino)propanamide |
| SMILES | C[C@@H](C(=O)N/N=C\c1ccc(OCC(=O)Nc2ccc(F)cc2)cc1)N(c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C25H25FN4O5S/c1-18(30(36(2,33)34)22-6-4-3-5-7-22)25(32)29-27-16-19-8-14-23(15-9-19)35-17-24(31)28-21-12-10-20(26)11-13-21/h3-16,18H,17H2,1-2H3,(H,28,31)(H,29,32)/b27-16-/t18-/m0/s1 |
| InChIKey | JEMWZVROKCNREZ-GEGDGZKASA-N |
| XLogP | 3.15 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|