C21H28N4O3S — CID 40566756
(2S)-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-2-(N-methylsulfonylanilino)propanamide (PubChem CID 40566756) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is (2S)-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-2-(N-methylsulfonylanilino)propanamide.
| Compound Name | (2S)-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-2-(N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 40566756 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | (2S)-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-2-(N-methylsulfonylanilino)propanamide |
| SMILES | CCN(CC)c1ccc(/C=N\NC(=O)[C@H](C)N(c2ccccc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H28N4O3S/c1-5-24(6-2)19-14-12-18(13-15-19)16-22-23-21(26)17(3)25(29(4,27)28)20-10-8-7-9-11-20/h7-17H,5-6H2,1-4H3,(H,23,26)/b22-16-/t17-/m0/s1 |
| InChIKey | VBLWHBKGLVVUCH-DBZAVIBRSA-N |
| XLogP | 2.84 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|