C17H17Cl2N3O3S — CID 40567563
(2R)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-2-(N-methylsulfonylanilino)propanamide (PubChem CID 40567563) has the molecular formula C17H17Cl2N3O3S and a molecular weight of 414.31 g/mol. Its IUPAC name is (2R)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-2-(N-methylsulfonylanilino)propanamide.
| Compound Name | (2R)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-2-(N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 40567563 |
| Molecular Formula | C17H17Cl2N3O3S |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | (2R)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-2-(N-methylsulfonylanilino)propanamide |
| SMILES | C[C@H](C(=O)N/N=C\c1ccc(Cl)c(Cl)c1)N(c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C17H17Cl2N3O3S/c1-12(22(26(2,24)25)14-6-4-3-5-7-14)17(23)21-20-11-13-8-9-15(18)16(19)10-13/h3-12H,1-2H3,(H,21,23)/b20-11-/t12-/m1/s1 |
| InChIKey | NTSNMSBIEOOJEU-WXYNYTDUSA-N |
| XLogP | 3.30 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|