C27H29ClN4O6S — CID 9498467
(2R)-N-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(4-ethoxy-N-methylsulfonylanilino)propanamide (PubChem CID 9498467) has the molecular formula C27H29ClN4O6S and a molecular weight of 573.07 g/mol. Its IUPAC name is (2R)-N-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(4-ethoxy-N-methylsulfonylanilino)propanamide.
| Compound Name | (2R)-N-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(4-ethoxy-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 9498467 |
| Molecular Formula | C27H29ClN4O6S |
| Molecular Weight | 573.07 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | (2R)-N-[(Z)-[4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(4-ethoxy-N-methylsulfonylanilino)propanamide |
| SMILES | CCOc1ccc(N([C@H](C)C(=O)N/N=C\c2ccc(OCC(=O)Nc3ccccc3Cl)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C27H29ClN4O6S/c1-4-37-22-15-11-21(12-16-22)32(39(3,35)36)19(2)27(34)31-29-17-20-9-13-23(14-10-20)38-18-26(33)30-25-8-6-5-7-24(25)28/h5-17,19H,4,18H2,1-3H3,(H,30,33)(H,31,34)/b29-17-/t19-/m1/s1 |
| InChIKey | SEAQEBVYJZVPAE-KIOJSIHTSA-N |
| XLogP | 4.06 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.07 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|