C32H32N4O6S — CID 126030614
(2S)-N-[(Z)-[4-[2-(benzylamino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide (PubChem CID 126030614) has the molecular formula C32H32N4O6S and a molecular weight of 600.70 g/mol. Its IUPAC name is (2S)-N-[(Z)-[4-[2-(benzylamino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide.
| Compound Name | (2S)-N-[(Z)-[4-[2-(benzylamino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide |
|---|---|
| PubChem CID | 126030614 |
| Molecular Formula | C32H32N4O6S |
| Molecular Weight | 600.70 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | (2S)-N-[(Z)-[4-[2-(benzylamino)-2-oxoethoxy]phenyl]methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide |
| SMILES | C[C@@H](C(=O)N/N=C\c1ccc(OCC(=O)NCc2ccccc2)cc1)N(c1ccc(Oc2ccccc2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C32H32N4O6S/c1-24(36(43(2,39)40)27-15-19-30(20-16-27)42-29-11-7-4-8-12-29)32(38)35-34-22-26-13-17-28(18-14-26)41-23-31(37)33-21-25-9-5-3-6-10-25/h3-20,22,24H,21,23H2,1-2H3,(H,33,37)(H,35,38)/b34-22-/t24-/m0/s1 |
| InChIKey | HOYITGBSGAYWGS-OOADULSRSA-N |
| XLogP | 4.48 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.70 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|