C32H32ClN3O6S — CID 126032720
(2S)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide (PubChem CID 126032720) has the molecular formula C32H32ClN3O6S and a molecular weight of 622.14 g/mol. Its IUPAC name is (2S)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide.
| Compound Name | (2S)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide |
|---|---|
| PubChem CID | 126032720 |
| Molecular Formula | C32H32ClN3O6S |
| Molecular Weight | 622.14 g/mol |
| Exact Mass | 621.17 |
| IUPAC Name | (2S)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(N-methylsulfonyl-4-phenoxyanilino)propanamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@H](C)N(c2ccc(Oc3ccccc3)cc2)S(C)(=O)=O)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H32ClN3O6S/c1-4-40-31-20-25(12-19-30(31)41-22-24-10-13-26(33)14-11-24)21-34-35-32(37)23(2)36(43(3,38)39)27-15-17-29(18-16-27)42-28-8-6-5-7-9-28/h5-21,23H,4,22H2,1-3H3,(H,35,37)/b34-21-/t23-/m0/s1 |
| InChIKey | INUOCOQTUNELIM-OVPXFRHASA-N |
| XLogP | 6.41 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.14 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|