C25H25ClIN3O5S — CID 126033373
N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(4-iodo-N-methylsulfonylanilino)acetamide (PubChem CID 126033373) has the molecular formula C25H25ClIN3O5S and a molecular weight of 641.92 g/mol. Its IUPAC name is N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(4-iodo-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(4-iodo-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126033373 |
| Molecular Formula | C25H25ClIN3O5S |
| Molecular Weight | 641.92 g/mol |
| Exact Mass | 641.02 |
| IUPAC Name | N-[(Z)-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(4-iodo-N-methylsulfonylanilino)acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CN(c2ccc(I)cc2)S(C)(=O)=O)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H25ClIN3O5S/c1-3-34-24-14-19(6-13-23(24)35-17-18-4-7-20(26)8-5-18)15-28-29-25(31)16-30(36(2,32)33)22-11-9-21(27)10-12-22/h4-15H,3,16-17H2,1-2H3,(H,29,31)/b28-15- |
| InChIKey | FCWADSJDWTWQSN-MBTHVWNTSA-N |
| XLogP | 4.84 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.92 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|