C20H24BrN3O5S — CID 92661124
2-(2-bromo-N-methylsulfonylanilino)-N-[(Z)-(3,4-diethoxyphenyl)methylideneamino]acetamide (PubChem CID 92661124) has the molecular formula C20H24BrN3O5S and a molecular weight of 498.40 g/mol. Its IUPAC name is 2-(2-bromo-N-methylsulfonylanilino)-N-[(Z)-(3,4-diethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-N-methylsulfonylanilino)-N-[(Z)-(3,4-diethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 92661124 |
| Molecular Formula | C20H24BrN3O5S |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | 2-(2-bromo-N-methylsulfonylanilino)-N-[(Z)-(3,4-diethoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1ccc(/C=N\NC(=O)CN(c2ccccc2Br)S(C)(=O)=O)cc1OCC |
| InChI | InChI=1S/C20H24BrN3O5S/c1-4-28-18-11-10-15(12-19(18)29-5-2)13-22-23-20(25)14-24(30(3,26)27)17-9-7-6-8-16(17)21/h6-13H,4-5,14H2,1-3H3,(H,23,25)/b22-13- |
| InChIKey | OPBACBPAXSFVMR-XKZIYDEJSA-N |
| XLogP | 3.16 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|