C18H17BrN4O4S — CID 4688244
2-(2-bromo-N-methylsulfonylanilino)-N-[[4-(cyanomethoxy)phenyl]methylideneamino]acetamide (PubChem CID 4688244) has the molecular formula C18H17BrN4O4S and a molecular weight of 465.33 g/mol. Its IUPAC name is 2-(2-bromo-N-methylsulfonylanilino)-N-[[4-(cyanomethoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-N-methylsulfonylanilino)-N-[[4-(cyanomethoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 4688244 |
| Molecular Formula | C18H17BrN4O4S |
| Molecular Weight | 465.33 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | 2-(2-bromo-N-methylsulfonylanilino)-N-[[4-(cyanomethoxy)phenyl]methylideneamino]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NN=Cc1ccc(OCC#N)cc1)c1ccccc1Br |
| InChI | InChI=1S/C18H17BrN4O4S/c1-28(25,26)23(17-5-3-2-4-16(17)19)13-18(24)22-21-12-14-6-8-15(9-7-14)27-11-10-20/h2-9,12H,11,13H2,1H3,(H,22,24) |
| InChIKey | PBROVPCAAZCSDN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|