C18H20BrN3O4S — CID 43879695
2-(3-bromo-N-methylsulfonylanilino)-N-[(E)-(4-ethoxyphenyl)methylideneamino]acetamide (PubChem CID 43879695) has the molecular formula C18H20BrN3O4S and a molecular weight of 454.35 g/mol. Its IUPAC name is 2-(3-bromo-N-methylsulfonylanilino)-N-[(E)-(4-ethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(3-bromo-N-methylsulfonylanilino)-N-[(E)-(4-ethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 43879695 |
| Molecular Formula | C18H20BrN3O4S |
| Molecular Weight | 454.35 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | 2-(3-bromo-N-methylsulfonylanilino)-N-[(E)-(4-ethoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1ccc(/C=N/NC(=O)CN(c2cccc(Br)c2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H20BrN3O4S/c1-3-26-17-9-7-14(8-10-17)12-20-21-18(23)13-22(27(2,24)25)16-6-4-5-15(19)11-16/h4-12H,3,13H2,1-2H3,(H,21,23)/b20-12+ |
| InChIKey | KHZVUEMBFYELDF-UDWIEESQSA-N |
| XLogP | 2.76 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|