C23H20FN3O5S — CID 126135462
[4-[(Z)-[[2-(3-fluoro-N-methylsulfonylanilino)acetyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 126135462) has the molecular formula C23H20FN3O5S and a molecular weight of 469.49 g/mol. Its IUPAC name is [4-[(Z)-[[2-(3-fluoro-N-methylsulfonylanilino)acetyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [4-[(Z)-[[2-(3-fluoro-N-methylsulfonylanilino)acetyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 126135462 |
| Molecular Formula | C23H20FN3O5S |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | [4-[(Z)-[[2-(3-fluoro-N-methylsulfonylanilino)acetyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | CS(=O)(=O)N(CC(=O)N/N=C\c1ccc(OC(=O)c2ccccc2)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C23H20FN3O5S/c1-33(30,31)27(20-9-5-8-19(24)14-20)16-22(28)26-25-15-17-10-12-21(13-11-17)32-23(29)18-6-3-2-4-7-18/h2-15H,16H2,1H3,(H,26,28)/b25-15- |
| InChIKey | IXBQUUMEGVCERJ-MYYYXRDXSA-N |
| XLogP | 2.96 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|