C18H18FN3O5S — CID 126139493
N-[(Z)-2,3-dihydro-1,4-benzodioxin-5-ylmethylideneamino]-2-(3-fluoro-N-methylsulfonylanilino)acetamide (PubChem CID 126139493) has the molecular formula C18H18FN3O5S and a molecular weight of 407.42 g/mol. Its IUPAC name is N-[(Z)-2,3-dihydro-1,4-benzodioxin-5-ylmethylideneamino]-2-(3-fluoro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(Z)-2,3-dihydro-1,4-benzodioxin-5-ylmethylideneamino]-2-(3-fluoro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126139493 |
| Molecular Formula | C18H18FN3O5S |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | N-[(Z)-2,3-dihydro-1,4-benzodioxin-5-ylmethylideneamino]-2-(3-fluoro-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)N/N=C\c1cccc2c1OCCO2)c1cccc(F)c1 |
| InChI | InChI=1S/C18H18FN3O5S/c1-28(24,25)22(15-6-3-5-14(19)10-15)12-17(23)21-20-11-13-4-2-7-16-18(13)27-9-8-26-16/h2-7,10-11H,8-9,12H2,1H3,(H,21,23)/b20-11- |
| InChIKey | PCNGMMLCTOEEAY-JAIQZWGSSA-N |
| XLogP | 1.51 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|