C23H20ClN3O5S — CID 94838133
2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[(Z)-2,3-dihydro-1,4-benzodioxin-5-ylmethylideneamino]acetamide (PubChem CID 94838133) has the molecular formula C23H20ClN3O5S and a molecular weight of 485.95 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[(Z)-2,3-dihydro-1,4-benzodioxin-5-ylmethylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[(Z)-2,3-dihydro-1,4-benzodioxin-5-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 94838133 |
| Molecular Formula | C23H20ClN3O5S |
| Molecular Weight | 485.95 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[(Z)-2,3-dihydro-1,4-benzodioxin-5-ylmethylideneamino]acetamide |
| SMILES | O=C(CN(c1ccc(Cl)cc1)S(=O)(=O)c1ccccc1)N/N=C\c1cccc2c1OCCO2 |
| InChI | InChI=1S/C23H20ClN3O5S/c24-18-9-11-19(12-10-18)27(33(29,30)20-6-2-1-3-7-20)16-22(28)26-25-15-17-5-4-8-21-23(17)32-14-13-31-21/h1-12,15H,13-14,16H2,(H,26,28)/b25-15- |
| InChIKey | FVQGJXWQIDSTCX-MYYYXRDXSA-N |
| XLogP | 3.46 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.95 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|