C28H32ClN3O4S — CID 3620316
2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[(2-heptoxyphenyl)methylideneamino]acetamide (PubChem CID 3620316) has the molecular formula C28H32ClN3O4S and a molecular weight of 542.10 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[(2-heptoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[(2-heptoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3620316 |
| Molecular Formula | C28H32ClN3O4S |
| Molecular Weight | 542.10 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-chloroanilino]-N-[(2-heptoxyphenyl)methylideneamino]acetamide |
| SMILES | CCCCCCCOc1ccccc1C=NNC(=O)CN(c1ccc(Cl)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H32ClN3O4S/c1-2-3-4-5-11-20-36-27-15-10-9-12-23(27)21-30-31-28(33)22-32(25-18-16-24(29)17-19-25)37(34,35)26-13-7-6-8-14-26/h6-10,12-19,21H,2-5,11,20,22H2,1H3,(H,31,33) |
| InChIKey | DMJJKMZGBWWFIH-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.10 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|