C24H21ClF3N3O4S — CID 98082541
2-(N-(4-chlorophenyl)sulfonyl-4-ethoxyanilino)-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide (PubChem CID 98082541) has the molecular formula C24H21ClF3N3O4S and a molecular weight of 539.96 g/mol. Its IUPAC name is 2-(N-(4-chlorophenyl)sulfonyl-4-ethoxyanilino)-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(N-(4-chlorophenyl)sulfonyl-4-ethoxyanilino)-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 98082541 |
| Molecular Formula | C24H21ClF3N3O4S |
| Molecular Weight | 539.96 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | 2-(N-(4-chlorophenyl)sulfonyl-4-ethoxyanilino)-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]acetamide |
| SMILES | CCOc1ccc(N(CC(=O)N/N=C\c2ccccc2C(F)(F)F)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H21ClF3N3O4S/c1-2-35-20-11-9-19(10-12-20)31(36(33,34)21-13-7-18(25)8-14-21)16-23(32)30-29-15-17-5-3-4-6-22(17)24(26,27)28/h3-15H,2,16H2,1H3,(H,30,32)/b29-15- |
| InChIKey | ZVBLJRDENIPEQY-FDVSRXAVSA-N |
| XLogP | 5.10 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.96 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|