C24H24FN3O4S — CID 28588927
2-(4-ethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide (PubChem CID 28588927) has the molecular formula C24H24FN3O4S and a molecular weight of 469.54 g/mol. Its IUPAC name is 2-(4-ethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-ethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 28588927 |
| Molecular Formula | C24H24FN3O4S |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 2-(4-ethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide |
| SMILES | CCOc1ccc(N(CC(=O)N/N=C\c2ccccc2F)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H24FN3O4S/c1-3-32-21-12-10-20(11-13-21)28(33(30,31)22-14-8-18(2)9-15-22)17-24(29)27-26-16-19-6-4-5-7-23(19)25/h4-16H,3,17H2,1-2H3,(H,27,29)/b26-16- |
| InChIKey | GNGKNXRDTWWHJY-QQXSKIMKSA-N |
| XLogP | 3.88 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|