C28H27ClN4O5S — CID 3128292
N-[(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]-2-(N-(4-ethoxyphenyl)sulfonyl-4-methylanilino)acetamide (PubChem CID 3128292) has the molecular formula C28H27ClN4O5S and a molecular weight of 567.07 g/mol. Its IUPAC name is N-[(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]-2-(N-(4-ethoxyphenyl)sulfonyl-4-methylanilino)acetamide.
| Compound Name | N-[(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]-2-(N-(4-ethoxyphenyl)sulfonyl-4-methylanilino)acetamide |
|---|---|
| PubChem CID | 3128292 |
| Molecular Formula | C28H27ClN4O5S |
| Molecular Weight | 567.07 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | N-[(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]-2-(N-(4-ethoxyphenyl)sulfonyl-4-methylanilino)acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC(=O)NN=Cc2cc3ccc(OC)cc3nc2Cl)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H27ClN4O5S/c1-4-38-23-11-13-25(14-12-23)39(35,36)33(22-8-5-19(2)6-9-22)18-27(34)32-30-17-21-15-20-7-10-24(37-3)16-26(20)31-28(21)29/h5-17H,4,18H2,1-3H3,(H,32,34) |
| InChIKey | GOALKIFCASKIOH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.07 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|