C27H25ClN4O4S — CID 98103073
2-[N-(benzenesulfonyl)-3,4-dimethylanilino]-N-[(Z)-(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]acetamide (PubChem CID 98103073) has the molecular formula C27H25ClN4O4S and a molecular weight of 537.04 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3,4-dimethylanilino]-N-[(Z)-(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3,4-dimethylanilino]-N-[(Z)-(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 98103073 |
| Molecular Formula | C27H25ClN4O4S |
| Molecular Weight | 537.04 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3,4-dimethylanilino]-N-[(Z)-(2-chloro-7-methoxyquinolin-3-yl)methylideneamino]acetamide |
| SMILES | COc1ccc2cc(/C=N\NC(=O)CN(c3ccc(C)c(C)c3)S(=O)(=O)c3ccccc3)c(Cl)nc2c1 |
| InChI | InChI=1S/C27H25ClN4O4S/c1-18-9-11-22(13-19(18)2)32(37(34,35)24-7-5-4-6-8-24)17-26(33)31-29-16-21-14-20-10-12-23(36-3)15-25(20)30-27(21)28/h4-16H,17H2,1-3H3,(H,31,33)/b29-16- |
| InChIKey | PUPWREKGJCDNEN-MWLSYYOVSA-N |
| XLogP | 4.86 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.04 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|