C26H23ClN4O3S — CID 92648472
2-[N-(benzenesulfonyl)-3,4-dimethylanilino]-N-[(Z)-(2-chloroquinolin-3-yl)methylideneamino]acetamide (PubChem CID 92648472) has the molecular formula C26H23ClN4O3S and a molecular weight of 507.02 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3,4-dimethylanilino]-N-[(Z)-(2-chloroquinolin-3-yl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3,4-dimethylanilino]-N-[(Z)-(2-chloroquinolin-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 92648472 |
| Molecular Formula | C26H23ClN4O3S |
| Molecular Weight | 507.02 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3,4-dimethylanilino]-N-[(Z)-(2-chloroquinolin-3-yl)methylideneamino]acetamide |
| SMILES | Cc1ccc(N(CC(=O)N/N=C\c2cc3ccccc3nc2Cl)S(=O)(=O)c2ccccc2)cc1C |
| InChI | InChI=1S/C26H23ClN4O3S/c1-18-12-13-22(14-19(18)2)31(35(33,34)23-9-4-3-5-10-23)17-25(32)30-28-16-21-15-20-8-6-7-11-24(20)29-26(21)27/h3-16H,17H2,1-2H3,(H,30,32)/b28-16- |
| InChIKey | IJRNMVHGLNDXEC-NTFVMDSBSA-N |
| XLogP | 4.85 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.02 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|