C24H18Cl2N4O3S — CID 92648474
2-[N-(benzenesulfonyl)-2-chloroanilino]-N-[(Z)-(2-chloroquinolin-3-yl)methylideneamino]acetamide (PubChem CID 92648474) has the molecular formula C24H18Cl2N4O3S and a molecular weight of 513.41 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-chloroanilino]-N-[(Z)-(2-chloroquinolin-3-yl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-chloroanilino]-N-[(Z)-(2-chloroquinolin-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 92648474 |
| Molecular Formula | C24H18Cl2N4O3S |
| Molecular Weight | 513.41 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-chloroanilino]-N-[(Z)-(2-chloroquinolin-3-yl)methylideneamino]acetamide |
| SMILES | O=C(CN(c1ccccc1Cl)S(=O)(=O)c1ccccc1)N/N=C\c1cc2ccccc2nc1Cl |
| InChI | InChI=1S/C24H18Cl2N4O3S/c25-20-11-5-7-13-22(20)30(34(32,33)19-9-2-1-3-10-19)16-23(31)29-27-15-18-14-17-8-4-6-12-21(17)28-24(18)26/h1-15H,16H2,(H,29,31)/b27-15- |
| InChIKey | GUBXZNGHFQSDAP-DICXZTSXSA-N |
| XLogP | 4.89 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.41 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|