C25H19Cl2N3O3S — CID 28588593
2-[N-(benzenesulfonyl)-2,3-dichloroanilino]-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide (PubChem CID 28588593) has the molecular formula C25H19Cl2N3O3S and a molecular weight of 512.42 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,3-dichloroanilino]-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,3-dichloroanilino]-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 28588593 |
| Molecular Formula | C25H19Cl2N3O3S |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 511.05 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,3-dichloroanilino]-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide |
| SMILES | O=C(CN(c1cccc(Cl)c1Cl)S(=O)(=O)c1ccccc1)N/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C25H19Cl2N3O3S/c26-22-14-7-15-23(25(22)27)30(34(32,33)20-11-2-1-3-12-20)17-24(31)29-28-16-19-10-6-9-18-8-4-5-13-21(18)19/h1-16H,17H2,(H,29,31)/b28-16- |
| InChIKey | ABJIQEVLXHRXBM-NTFVMDSBSA-N |
| XLogP | 5.49 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|