C19H15Cl2N3O4S — CID 28588594
2-[N-(benzenesulfonyl)-2,3-dichloroanilino]-N-[(Z)-furan-2-ylmethylideneamino]acetamide (PubChem CID 28588594) has the molecular formula C19H15Cl2N3O4S and a molecular weight of 452.32 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,3-dichloroanilino]-N-[(Z)-furan-2-ylmethylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,3-dichloroanilino]-N-[(Z)-furan-2-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 28588594 |
| Molecular Formula | C19H15Cl2N3O4S |
| Molecular Weight | 452.32 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,3-dichloroanilino]-N-[(Z)-furan-2-ylmethylideneamino]acetamide |
| SMILES | O=C(CN(c1cccc(Cl)c1Cl)S(=O)(=O)c1ccccc1)N/N=C\c1ccco1 |
| InChI | InChI=1S/C19H15Cl2N3O4S/c20-16-9-4-10-17(19(16)21)24(29(26,27)15-7-2-1-3-8-15)13-18(25)23-22-12-14-6-5-11-28-14/h1-12H,13H2,(H,23,25)/b22-12- |
| InChIKey | SVIRYANNNHBKPP-UUYOSTAYSA-N |
| XLogP | 3.93 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|