C22H20ClN3O4S — CID 92644288
2-[N-(benzenesulfonyl)-2-chloroanilino]-N-[(Z)-(4-methoxyphenyl)methylideneamino]acetamide (PubChem CID 92644288) has the molecular formula C22H20ClN3O4S and a molecular weight of 457.94 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-chloroanilino]-N-[(Z)-(4-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-chloroanilino]-N-[(Z)-(4-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 92644288 |
| Molecular Formula | C22H20ClN3O4S |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-chloroanilino]-N-[(Z)-(4-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(/C=N\NC(=O)CN(c2ccccc2Cl)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20ClN3O4S/c1-30-18-13-11-17(12-14-18)15-24-25-22(27)16-26(21-10-6-5-9-20(21)23)31(28,29)19-7-3-2-4-8-19/h2-15H,16H2,1H3,(H,25,27)/b24-15- |
| InChIKey | IUUAKSGSRJPTIG-IWIPYMOSSA-N |
| XLogP | 3.69 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|