C29H28N4O4S — CID 4663625
2-[N-(benzenesulfonyl)-2-methoxyanilino]-N-[[4-(N-methylanilino)phenyl]methylideneamino]acetamide (PubChem CID 4663625) has the molecular formula C29H28N4O4S and a molecular weight of 528.63 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-methoxyanilino]-N-[[4-(N-methylanilino)phenyl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-methoxyanilino]-N-[[4-(N-methylanilino)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 4663625 |
| Molecular Formula | C29H28N4O4S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-methoxyanilino]-N-[[4-(N-methylanilino)phenyl]methylideneamino]acetamide |
| SMILES | COc1ccccc1N(CC(=O)NN=Cc1ccc(N(C)c2ccccc2)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H28N4O4S/c1-32(24-11-5-3-6-12-24)25-19-17-23(18-20-25)21-30-31-29(34)22-33(27-15-9-10-16-28(27)37-2)38(35,36)26-13-7-4-8-14-26/h3-21H,22H2,1-2H3,(H,31,34) |
| InChIKey | IODAXSCXMSYYTI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|