C26H29N3O7S — CID 94838348
2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 94838348) has the molecular formula C26H29N3O7S and a molecular weight of 527.60 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 94838348 |
| Molecular Formula | C26H29N3O7S |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)N/N=C\c1cc(OC)c(OC)c(OC)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H29N3O7S/c1-5-36-22-14-10-9-13-21(22)29(37(31,32)20-11-7-6-8-12-20)18-25(30)28-27-17-19-15-23(33-2)26(35-4)24(16-19)34-3/h6-17H,5,18H2,1-4H3,(H,28,30)/b27-17- |
| InChIKey | RZUKIJMUVXKXKD-PKAZHMFMSA-N |
| XLogP | 3.46 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|