C24H23BrClN3O6S — CID 137043523
N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetamide (PubChem CID 137043523) has the molecular formula C24H23BrClN3O6S and a molecular weight of 596.89 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetamide.
| Compound Name | N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetamide |
|---|---|
| PubChem CID | 137043523 |
| Molecular Formula | C24H23BrClN3O6S |
| Molecular Weight | 596.89 g/mol |
| Exact Mass | 595.02 |
| IUPAC Name | N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)N/N=C\c1cc(Br)c(O)c(OC)c1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23BrClN3O6S/c1-3-35-21-7-5-4-6-20(21)29(36(32,33)18-10-8-17(26)9-11-18)15-23(30)28-27-14-16-12-19(25)24(31)22(13-16)34-2/h4-14,31H,3,15H2,1-2H3,(H,28,30)/b27-14- |
| InChIKey | UBNPCBMFJKNGOU-VYYCAZPPSA-N |
| XLogP | 4.56 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.89 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|