C27H31ClN4O4S — CID 126142995
2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]acetamide (PubChem CID 126142995) has the molecular formula C27H31ClN4O4S and a molecular weight of 543.09 g/mol. Its IUPAC name is 2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126142995 |
| Molecular Formula | C27H31ClN4O4S |
| Molecular Weight | 543.09 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | 2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)-N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)N/N=C\c1ccc(N(CC)CC)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H31ClN4O4S/c1-4-31(5-2)23-15-11-21(12-16-23)19-29-30-27(33)20-32(25-9-7-8-10-26(25)36-6-3)37(34,35)24-17-13-22(28)14-18-24/h7-19H,4-6,20H2,1-3H3,(H,30,33)/b29-19- |
| InChIKey | ULRKGZIQDKDYQK-CEUNXORHSA-N |
| XLogP | 4.93 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.09 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|