C24H22ClN3O6S — CID 126134639
N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetamide (PubChem CID 126134639) has the molecular formula C24H22ClN3O6S and a molecular weight of 515.98 g/mol. Its IUPAC name is N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetamide.
| Compound Name | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetamide |
|---|---|
| PubChem CID | 126134639 |
| Molecular Formula | C24H22ClN3O6S |
| Molecular Weight | 515.98 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)N/N=C\c1ccc2c(c1)OCO2)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22ClN3O6S/c1-2-32-21-6-4-3-5-20(21)28(35(30,31)19-10-8-18(25)9-11-19)15-24(29)27-26-14-17-7-12-22-23(13-17)34-16-33-22/h3-14H,2,15-16H2,1H3,(H,27,29)/b26-14- |
| InChIKey | FFFRPKXRTAUYJT-WGARJPEWSA-N |
| XLogP | 3.81 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.98 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|