C29H24ClN3O5S — CID 43878926
N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 43878926) has the molecular formula C29H24ClN3O5S and a molecular weight of 562.05 g/mol. Its IUPAC name is N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 43878926 |
| Molecular Formula | C29H24ClN3O5S |
| Molecular Weight | 562.05 g/mol |
| Exact Mass | 561.11 |
| IUPAC Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccc(Cl)cc2)c2ccccc2C(=O)N/N=C/c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C29H24ClN3O5S/c1-20-6-13-24(14-7-20)39(35,36)33(18-21-8-11-23(30)12-9-21)26-5-3-2-4-25(26)29(34)32-31-17-22-10-15-27-28(16-22)38-19-37-27/h2-17H,18-19H2,1H3,(H,32,34)/b31-17+ |
| InChIKey | HUAQLYLJGCTNCM-KBVAKVRCSA-N |
| XLogP | 5.54 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.05 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|