C38H35ClN4O5S — CID 126191769
2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-[4-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethoxy]phenyl]methylideneamino]benzamide (PubChem CID 126191769) has the molecular formula C38H35ClN4O5S and a molecular weight of 695.24 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-[4-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-[4-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126191769 |
| Molecular Formula | C38H35ClN4O5S |
| Molecular Weight | 695.24 g/mol |
| Exact Mass | 694.20 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-[4-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethoxy]phenyl]methylideneamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccc(Cl)cc2)c2ccccc2C(=O)N/N=C\c2ccc(OCC(=O)N[C@H](C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C38H35ClN4O5S/c1-27-12-22-34(23-13-27)49(46,47)43(25-30-14-18-32(39)19-15-30)36-11-7-6-10-35(36)38(45)42-40-24-29-16-20-33(21-17-29)48-26-37(44)41-28(2)31-8-4-3-5-9-31/h3-24,28H,25-26H2,1-2H3,(H,41,44)(H,42,45)/b40-24-/t28-/m1/s1 |
| InChIKey | ZRDMUOFBOWDVIT-ICYSTXJGSA-N |
| XLogP | 7.06 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.24 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|