C29H23ClF3N3O3S — CID 4605428
2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[[3-(trifluoromethyl)phenyl]methylideneamino]benzamide (PubChem CID 4605428) has the molecular formula C29H23ClF3N3O3S and a molecular weight of 586.04 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[[3-(trifluoromethyl)phenyl]methylideneamino]benzamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[[3-(trifluoromethyl)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 4605428 |
| Molecular Formula | C29H23ClF3N3O3S |
| Molecular Weight | 586.04 g/mol |
| Exact Mass | 585.11 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[[3-(trifluoromethyl)phenyl]methylideneamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccc(Cl)cc2)c2ccccc2C(=O)NN=Cc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C29H23ClF3N3O3S/c1-20-9-15-25(16-10-20)40(38,39)36(19-21-11-13-24(30)14-12-21)27-8-3-2-7-26(27)28(37)35-34-18-22-5-4-6-23(17-22)29(31,32)33/h2-18H,19H2,1H3,(H,35,37) |
| InChIKey | AVVHVGUABIMRTB-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.04 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|