C16H13F3N2O — CID 4924395
2-methyl-N-[[3-(trifluoromethyl)phenyl]methylideneamino]benzamide (PubChem CID 4924395) has the molecular formula C16H13F3N2O and a molecular weight of 306.29 g/mol. Its IUPAC name is 2-methyl-N-[[3-(trifluoromethyl)phenyl]methylideneamino]benzamide.
| Compound Name | 2-methyl-N-[[3-(trifluoromethyl)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 4924395 |
| Molecular Formula | C16H13F3N2O |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-methyl-N-[[3-(trifluoromethyl)phenyl]methylideneamino]benzamide |
| SMILES | Cc1ccccc1C(=O)NN=Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13F3N2O/c1-11-5-2-3-8-14(11)15(22)21-20-10-12-6-4-7-13(9-12)16(17,18)19/h2-10H,1H3,(H,21,22) |
| InChIKey | KWLAADGSGIOQJX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|