C21H15ClF3N3O2 — CID 110524357
1-[(2-chlorophenyl)methyl]-2-oxo-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]pyridine-3-carboxamide (PubChem CID 110524357) has the molecular formula C21H15ClF3N3O2 and a molecular weight of 433.82 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-2-oxo-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]pyridine-3-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-2-oxo-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110524357 |
| Molecular Formula | C21H15ClF3N3O2 |
| Molecular Weight | 433.82 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-2-oxo-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]pyridine-3-carboxamide |
| SMILES | O=C(N/N=C\c1cccc(C(F)(F)F)c1)c1cccn(Cc2ccccc2Cl)c1=O |
| InChI | InChI=1S/C21H15ClF3N3O2/c22-18-9-2-1-6-15(18)13-28-10-4-8-17(20(28)30)19(29)27-26-12-14-5-3-7-16(11-14)21(23,24)25/h1-12H,13H2,(H,27,29)/b26-12- |
| InChIKey | KSKSXIOELNVAST-ZRGSRPPYSA-N |
| XLogP | 4.33 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.82 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|