C20H14Cl3N3O2 — CID 110524447
1-[(2-chlorophenyl)methyl]-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-oxopyridine-3-carboxamide (PubChem CID 110524447) has the molecular formula C20H14Cl3N3O2 and a molecular weight of 434.71 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-oxopyridine-3-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 110524447 |
| Molecular Formula | C20H14Cl3N3O2 |
| Molecular Weight | 434.71 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-oxopyridine-3-carboxamide |
| SMILES | O=C(N/N=C\c1c(Cl)cccc1Cl)c1cccn(Cc2ccccc2Cl)c1=O |
| InChI | InChI=1S/C20H14Cl3N3O2/c21-16-7-2-1-5-13(16)12-26-10-4-6-14(20(26)28)19(27)25-24-11-15-17(22)8-3-9-18(15)23/h1-11H,12H2,(H,25,27)/b24-11- |
| InChIKey | OAWRYYVMPNHGCC-MYKKPKGFSA-N |
| XLogP | 4.62 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.71 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|