C18H15F3N2O2 — CID 9220913
2-methyl-N'-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]benzohydrazide (PubChem CID 9220913) has the molecular formula C18H15F3N2O2 and a molecular weight of 348.32 g/mol. Its IUPAC name is 2-methyl-N'-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]benzohydrazide.
| Compound Name | 2-methyl-N'-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 9220913 |
| Molecular Formula | C18H15F3N2O2 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-methyl-N'-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]benzohydrazide |
| SMILES | Cc1ccccc1C(=O)NNC(=O)/C=C/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15F3N2O2/c1-12-5-2-3-8-15(12)17(25)23-22-16(24)10-9-13-6-4-7-14(11-13)18(19,20)21/h2-11H,1H3,(H,22,24)(H,23,25)/b10-9+ |
| InChIKey | DIGYRMBJECTFLB-MDZDMXLPSA-N |
| XLogP | 3.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|