C22H23F3N2O3 — CID 45109075
(4-tert-butylphenyl)methyl N-[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]carbamate (PubChem CID 45109075) has the molecular formula C22H23F3N2O3 and a molecular weight of 420.43 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl N-[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]carbamate.
| Compound Name | (4-tert-butylphenyl)methyl N-[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]carbamate |
|---|---|
| PubChem CID | 45109075 |
| Molecular Formula | C22H23F3N2O3 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (4-tert-butylphenyl)methyl N-[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]carbamate |
| SMILES | CC(C)(C)c1ccc(COC(=O)NNC(=O)/C=C/c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H23F3N2O3/c1-21(2,3)17-10-7-16(8-11-17)14-30-20(29)27-26-19(28)12-9-15-5-4-6-18(13-15)22(23,24)25/h4-13H,14H2,1-3H3,(H,26,28)(H,27,29)/b12-9+ |
| InChIKey | CMLSBWYCMFRONG-FMIVXFBMSA-N |
| XLogP | 4.97 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|