C14H15F3N2O2 — CID 9480508
(E)-N-[2-(dimethylamino)-2-oxoethyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 9480508) has the molecular formula C14H15F3N2O2 and a molecular weight of 300.28 g/mol. Its IUPAC name is (E)-N-[2-(dimethylamino)-2-oxoethyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-(dimethylamino)-2-oxoethyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 9480508 |
| Molecular Formula | C14H15F3N2O2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (E)-N-[2-(dimethylamino)-2-oxoethyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CN(C)C(=O)CNC(=O)/C=C/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F3N2O2/c1-19(2)13(21)9-18-12(20)7-6-10-4-3-5-11(8-10)14(15,16)17/h3-8H,9H2,1-2H3,(H,18,20)/b7-6+ |
| InChIKey | DBCMFKICKSYJCD-VOTSOKGWSA-N |
| XLogP | 1.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|