C15H17F3N2O2 — CID 8750344
(2R)-N-ethyl-2-[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]propanamide (PubChem CID 8750344) has the molecular formula C15H17F3N2O2 and a molecular weight of 314.31 g/mol. Its IUPAC name is (2R)-N-ethyl-2-[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]propanamide.
| Compound Name | (2R)-N-ethyl-2-[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]propanamide |
|---|---|
| PubChem CID | 8750344 |
| Molecular Formula | C15H17F3N2O2 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (2R)-N-ethyl-2-[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]propanamide |
| SMILES | CCNC(=O)[C@@H](C)NC(=O)/C=C/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F3N2O2/c1-3-19-14(22)10(2)20-13(21)8-7-11-5-4-6-12(9-11)15(16,17)18/h4-10H,3H2,1-2H3,(H,19,22)(H,20,21)/b8-7+/t10-/m1/s1 |
| InChIKey | CVYPAWIVICLPTR-QROSGCPLSA-N |
| XLogP | 2.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|