C19H18F3NO — CID 7957085
(E)-N-(4-propan-2-ylphenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 7957085) has the molecular formula C19H18F3NO and a molecular weight of 333.35 g/mol. Its IUPAC name is (E)-N-(4-propan-2-ylphenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(4-propan-2-ylphenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 7957085 |
| Molecular Formula | C19H18F3NO |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | (E)-N-(4-propan-2-ylphenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CC(C)c1ccc(NC(=O)/C=C/c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H18F3NO/c1-13(2)15-7-9-17(10-8-15)23-18(24)11-6-14-4-3-5-16(12-14)19(20,21)22/h3-13H,1-2H3,(H,23,24)/b11-6+ |
| InChIKey | CJHAQDWWMFMQBS-IZZDOVSWSA-N |
| XLogP | 5.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|