C23H26F3N2O+ — CID 74440295
N-[4-[(1-methylpiperidin-1-ium-1-yl)methyl]phenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 74440295) has the molecular formula C23H26F3N2O+ and a molecular weight of 403.47 g/mol. Its IUPAC name is N-[4-[(1-methylpiperidin-1-ium-1-yl)methyl]phenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[4-[(1-methylpiperidin-1-ium-1-yl)methyl]phenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 74440295 |
| Molecular Formula | C23H26F3N2O+ |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | N-[4-[(1-methylpiperidin-1-ium-1-yl)methyl]phenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | C[N+]1(Cc2ccc(NC(=O)C=Cc3cccc(C(F)(F)F)c3)cc2)CCCCC1 |
| InChI | InChI=1S/C23H25F3N2O/c1-28(14-3-2-4-15-28)17-19-8-11-21(12-9-19)27-22(29)13-10-18-6-5-7-20(16-18)23(24,25)26/h5-13,16H,2-4,14-15,17H2,1H3/p+1 |
| InChIKey | VLGXHFKPGYKSBJ-UHFFFAOYSA-O |
| XLogP | 5.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|