C24H28ClF3N2O2 — CID 171932298
N-[4-(aminomethyl)phenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide;4-chloro-3,5-dimethyloxane (PubChem CID 171932298) has the molecular formula C24H28ClF3N2O2 and a molecular weight of 468.95 g/mol. Its IUPAC name is N-[4-(aminomethyl)phenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide;4-chloro-3,5-dimethyloxane.
| Compound Name | N-[4-(aminomethyl)phenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide;4-chloro-3,5-dimethyloxane |
|---|---|
| PubChem CID | 171932298 |
| Molecular Formula | C24H28ClF3N2O2 |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | N-[4-(aminomethyl)phenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide;4-chloro-3,5-dimethyloxane |
| SMILES | CC1COCC(C)C1Cl.NCc1ccc(NC(=O)C=Cc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H15F3N2O.C7H13ClO/c18-17(19,20)14-3-1-2-12(10-14)6-9-16(23)22-15-7-4-13(11-21)5-8-15;1-5-3-9-4-6(2)7(5)8/h1-10H,11,21H2,(H,22,23);5-7H,3-4H2,1-2H3 |
| InChIKey | BRYNJQAAUXBJPG-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|