C16H10Cl2F3NO — CID 18808995
(E)-N-(2,6-dichlorophenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 18808995) has the molecular formula C16H10Cl2F3NO and a molecular weight of 360.16 g/mol. Its IUPAC name is (E)-N-(2,6-dichlorophenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2,6-dichlorophenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 18808995 |
| Molecular Formula | C16H10Cl2F3NO |
| Molecular Weight | 360.16 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | (E)-N-(2,6-dichlorophenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(C(F)(F)F)c1)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H10Cl2F3NO/c17-12-5-2-6-13(18)15(12)22-14(23)8-7-10-3-1-4-11(9-10)16(19,20)21/h1-9H,(H,22,23)/b8-7+ |
| InChIKey | OVGWKGVUHRMQMU-BQYQJAHWSA-N |
| XLogP | 5.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.16 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|