C20H17Cl2F3N2O2 — CID 34169666
(E)-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 34169666) has the molecular formula C20H17Cl2F3N2O2 and a molecular weight of 445.27 g/mol. Its IUPAC name is (E)-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 34169666 |
| Molecular Formula | C20H17Cl2F3N2O2 |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | (E)-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCN(CC(=O)Nc1c(Cl)cccc1Cl)C(=O)/C=C/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H17Cl2F3N2O2/c1-2-27(12-17(28)26-19-15(21)7-4-8-16(19)22)18(29)10-9-13-5-3-6-14(11-13)20(23,24)25/h3-11H,2,12H2,1H3,(H,26,28)/b10-9+ |
| InChIKey | VJYHCKHANBBMKM-MDZDMXLPSA-N |
| XLogP | 5.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|